C25H15Cl3F8N2O — CID 135341422
N'-(4-fluoro-2-methylphenyl)-4-[(Z)-1,4,4,4-tetrafluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]-2-(trifluoromethyl)benzohydrazide (PubChem CID 135341422) has the molecular formula C25H15Cl3F8N2O and a molecular weight of 617.75 g/mol. Its IUPAC name is N'-(4-fluoro-2-methylphenyl)-4-[(Z)-1,4,4,4-tetrafluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]-2-(trifluoromethyl)benzohydrazide.
| Compound Name | N'-(4-fluoro-2-methylphenyl)-4-[(Z)-1,4,4,4-tetrafluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]-2-(trifluoromethyl)benzohydrazide |
|---|---|
| PubChem CID | 135341422 |
| Molecular Formula | C25H15Cl3F8N2O |
| Molecular Weight | 617.75 g/mol |
| Exact Mass | 616.01 |
| IUPAC Name | N'-(4-fluoro-2-methylphenyl)-4-[(Z)-1,4,4,4-tetrafluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]-2-(trifluoromethyl)benzohydrazide |
| SMILES | Cc1cc(F)ccc1NNC(=O)c1ccc(/C(F)=C/C(c2cc(Cl)c(Cl)c(Cl)c2)C(F)(F)F)cc1C(F)(F)F |
| InChI | InChI=1S/C25H15Cl3F8N2O/c1-11-6-14(29)3-5-21(11)37-38-23(39)15-4-2-12(7-17(15)25(34,35)36)20(30)10-16(24(31,32)33)13-8-18(26)22(28)19(27)9-13/h2-10,16,37H,1H3,(H,38,39)/b20-10- |
| InChIKey | JWDVXVPMSDFMTA-JMIUGGIZSA-N |
| XLogP | 9.53 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.75 |
| LogP ≤ 5 | 9.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|