C25H11Cl3F10N4O5 — CID 135341308
N'-[2,6-dinitro-4-(trifluoromethyl)phenyl]-4-[1,4,4,4-tetrafluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]-2-(trifluoromethyl)benzohydrazide (PubChem CID 135341308) has the molecular formula C25H11Cl3F10N4O5 and a molecular weight of 743.72 g/mol. Its IUPAC name is N'-[2,6-dinitro-4-(trifluoromethyl)phenyl]-4-[1,4,4,4-tetrafluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]-2-(trifluoromethyl)benzohydrazide.
| Compound Name | N'-[2,6-dinitro-4-(trifluoromethyl)phenyl]-4-[1,4,4,4-tetrafluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]-2-(trifluoromethyl)benzohydrazide |
|---|---|
| PubChem CID | 135341308 |
| Molecular Formula | C25H11Cl3F10N4O5 |
| Molecular Weight | 743.72 g/mol |
| Exact Mass | 741.96 |
| IUPAC Name | N'-[2,6-dinitro-4-(trifluoromethyl)phenyl]-4-[1,4,4,4-tetrafluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]-2-(trifluoromethyl)benzohydrazide |
| SMILES | O=C(NNc1c([N+](=O)[O-])cc(C(F)(F)F)cc1[N+](=O)[O-])c1ccc(C(F)=CC(c2cc(Cl)c(Cl)c(Cl)c2)C(F)(F)F)cc1C(F)(F)F |
| InChI | InChI=1S/C25H11Cl3F10N4O5/c26-15-4-10(5-16(27)20(15)28)13(24(33,34)35)8-17(29)9-1-2-12(14(3-9)25(36,37)38)22(43)40-39-21-18(41(44)45)6-11(23(30,31)32)7-19(21)42(46)47/h1-8,13,39H,(H,40,43) |
| InChIKey | OOMMNCXUFVTSPZ-UHFFFAOYSA-N |
| XLogP | 9.91 |
| TPSA | 127.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 743.72 |
| LogP ≤ 5 | 9.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|