C21H13Cl3F7NOS — CID 130238196
4-[(Z)-1,4,4,4-tetrafluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]-N-(thietan-3-yl)-2-(trifluoromethyl)benzamide (PubChem CID 130238196) has the molecular formula C21H13Cl3F7NOS and a molecular weight of 566.75 g/mol. Its IUPAC name is 4-[(Z)-1,4,4,4-tetrafluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]-N-(thietan-3-yl)-2-(trifluoromethyl)benzamide.
| Compound Name | 4-[(Z)-1,4,4,4-tetrafluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]-N-(thietan-3-yl)-2-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 130238196 |
| Molecular Formula | C21H13Cl3F7NOS |
| Molecular Weight | 566.75 g/mol |
| Exact Mass | 564.97 |
| IUPAC Name | 4-[(Z)-1,4,4,4-tetrafluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]-N-(thietan-3-yl)-2-(trifluoromethyl)benzamide |
| SMILES | O=C(NC1CSC1)c1ccc(/C(F)=C/C(c2cc(Cl)c(Cl)c(Cl)c2)C(F)(F)F)cc1C(F)(F)F |
| InChI | InChI=1S/C21H13Cl3F7NOS/c22-15-4-10(5-16(23)18(15)24)13(20(26,27)28)6-17(25)9-1-2-12(14(3-9)21(29,30)31)19(33)32-11-7-34-8-11/h1-6,11,13H,7-8H2,(H,32,33)/b17-6- |
| InChIKey | KQCURCMTOBTCGG-FMQZQXMHSA-N |
| XLogP | 8.17 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.75 |
| LogP ≤ 5 | 8.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|