C22H12Cl3F7N2O — CID 135341545
N-pyrrol-1-yl-4-[(Z)-1,4,4,4-tetrafluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]-2-(trifluoromethyl)benzamide (PubChem CID 135341545) has the molecular formula C22H12Cl3F7N2O and a molecular weight of 559.70 g/mol. Its IUPAC name is N-pyrrol-1-yl-4-[(Z)-1,4,4,4-tetrafluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]-2-(trifluoromethyl)benzamide.
| Compound Name | N-pyrrol-1-yl-4-[(Z)-1,4,4,4-tetrafluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]-2-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 135341545 |
| Molecular Formula | C22H12Cl3F7N2O |
| Molecular Weight | 559.70 g/mol |
| Exact Mass | 557.99 |
| IUPAC Name | N-pyrrol-1-yl-4-[(Z)-1,4,4,4-tetrafluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]-2-(trifluoromethyl)benzamide |
| SMILES | O=C(Nn1cccc1)c1ccc(/C(F)=C/C(c2cc(Cl)c(Cl)c(Cl)c2)C(F)(F)F)cc1C(F)(F)F |
| InChI | InChI=1S/C22H12Cl3F7N2O/c23-16-8-12(9-17(24)19(16)25)14(21(27,28)29)10-18(26)11-3-4-13(15(7-11)22(30,31)32)20(35)33-34-5-1-2-6-34/h1-10,14H,(H,33,35)/b18-10- |
| InChIKey | WSEZMUKQYGUBJS-ZDLGFXPLSA-N |
| XLogP | 8.51 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.70 |
| LogP ≤ 5 | 8.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|