C23H12Cl4F7N3O — CID 135341639
N'-(5-chloro-2-pyridinyl)-4-[(Z)-1,4,4,4-tetrafluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]-2-(trifluoromethyl)benzohydrazide (PubChem CID 135341639) has the molecular formula C23H12Cl4F7N3O and a molecular weight of 621.17 g/mol. Its IUPAC name is N'-(5-chloro-2-pyridinyl)-4-[(Z)-1,4,4,4-tetrafluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]-2-(trifluoromethyl)benzohydrazide.
| Compound Name | N'-(5-chloro-2-pyridinyl)-4-[(Z)-1,4,4,4-tetrafluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]-2-(trifluoromethyl)benzohydrazide |
|---|---|
| PubChem CID | 135341639 |
| Molecular Formula | C23H12Cl4F7N3O |
| Molecular Weight | 621.17 g/mol |
| Exact Mass | 618.96 |
| IUPAC Name | N'-(5-chloro-2-pyridinyl)-4-[(Z)-1,4,4,4-tetrafluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]-2-(trifluoromethyl)benzohydrazide |
| SMILES | O=C(NNc1ccc(Cl)cn1)c1ccc(/C(F)=C/C(c2cc(Cl)c(Cl)c(Cl)c2)C(F)(F)F)cc1C(F)(F)F |
| InChI | InChI=1S/C23H12Cl4F7N3O/c24-12-2-4-19(35-9-12)36-37-21(38)13-3-1-10(5-15(13)23(32,33)34)18(28)8-14(22(29,30)31)11-6-16(25)20(27)17(26)7-11/h1-9,14H,(H,35,36)(H,37,38)/b18-8- |
| InChIKey | RFAUKCOXMVZYNU-LSCVHKIXSA-N |
| XLogP | 9.13 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.17 |
| LogP ≤ 5 | 9.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|