C22H12Cl3F7N4O — CID 135341665
N'-pyridazin-4-yl-4-[1,4,4,4-tetrafluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]-2-(trifluoromethyl)benzohydrazide (PubChem CID 135341665) has the molecular formula C22H12Cl3F7N4O and a molecular weight of 587.71 g/mol. Its IUPAC name is N'-pyridazin-4-yl-4-[1,4,4,4-tetrafluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]-2-(trifluoromethyl)benzohydrazide.
| Compound Name | N'-pyridazin-4-yl-4-[1,4,4,4-tetrafluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]-2-(trifluoromethyl)benzohydrazide |
|---|---|
| PubChem CID | 135341665 |
| Molecular Formula | C22H12Cl3F7N4O |
| Molecular Weight | 587.71 g/mol |
| Exact Mass | 586.00 |
| IUPAC Name | N'-pyridazin-4-yl-4-[1,4,4,4-tetrafluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]-2-(trifluoromethyl)benzohydrazide |
| SMILES | O=C(NNc1ccnnc1)c1ccc(C(F)=CC(c2cc(Cl)c(Cl)c(Cl)c2)C(F)(F)F)cc1C(F)(F)F |
| InChI | InChI=1S/C22H12Cl3F7N4O/c23-16-6-11(7-17(24)19(16)25)14(21(27,28)29)8-18(26)10-1-2-13(15(5-10)22(30,31)32)20(37)36-35-12-3-4-33-34-9-12/h1-9,14H,(H,33,35)(H,36,37) |
| InChIKey | KMNGOYBBQWUJPI-UHFFFAOYSA-N |
| XLogP | 7.87 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.71 |
| LogP ≤ 5 | 7.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|