C20H10Cl3F7N4O — CID 135341669
4-[1,4,4,4-tetrafluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]-N-(1,2,4-triazol-4-yl)-2-(trifluoromethyl)benzamide (PubChem CID 135341669) has the molecular formula C20H10Cl3F7N4O and a molecular weight of 561.67 g/mol. Its IUPAC name is 4-[1,4,4,4-tetrafluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]-N-(1,2,4-triazol-4-yl)-2-(trifluoromethyl)benzamide.
| Compound Name | 4-[1,4,4,4-tetrafluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]-N-(1,2,4-triazol-4-yl)-2-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 135341669 |
| Molecular Formula | C20H10Cl3F7N4O |
| Molecular Weight | 561.67 g/mol |
| Exact Mass | 559.98 |
| IUPAC Name | 4-[1,4,4,4-tetrafluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]-N-(1,2,4-triazol-4-yl)-2-(trifluoromethyl)benzamide |
| SMILES | O=C(Nn1cnnc1)c1ccc(C(F)=CC(c2cc(Cl)c(Cl)c(Cl)c2)C(F)(F)F)cc1C(F)(F)F |
| InChI | InChI=1S/C20H10Cl3F7N4O/c21-14-4-10(5-15(22)17(14)23)12(19(25,26)27)6-16(24)9-1-2-11(13(3-9)20(28,29)30)18(35)33-34-7-31-32-8-34/h1-8,12H,(H,33,35) |
| InChIKey | VDYSLKZHFSHJEG-UHFFFAOYSA-N |
| XLogP | 7.30 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.67 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|