C23H18Cl3F8NO3S — CID 130237481
N-[1-(2-fluoroethylsulfonyl)propan-2-yl]-4-[(Z)-1,4,4,4-tetrafluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]-2-(trifluoromethyl)benzamide (PubChem CID 130237481) has the molecular formula C23H18Cl3F8NO3S and a molecular weight of 646.81 g/mol. Its IUPAC name is N-[1-(2-fluoroethylsulfonyl)propan-2-yl]-4-[(Z)-1,4,4,4-tetrafluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]-2-(trifluoromethyl)benzamide.
| Compound Name | N-[1-(2-fluoroethylsulfonyl)propan-2-yl]-4-[(Z)-1,4,4,4-tetrafluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]-2-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 130237481 |
| Molecular Formula | C23H18Cl3F8NO3S |
| Molecular Weight | 646.81 g/mol |
| Exact Mass | 644.99 |
| IUPAC Name | N-[1-(2-fluoroethylsulfonyl)propan-2-yl]-4-[(Z)-1,4,4,4-tetrafluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]-2-(trifluoromethyl)benzamide |
| SMILES | CC(CS(=O)(=O)CCF)NC(=O)c1ccc(/C(F)=C/C(c2cc(Cl)c(Cl)c(Cl)c2)C(F)(F)F)cc1C(F)(F)F |
| InChI | InChI=1S/C23H18Cl3F8NO3S/c1-11(10-39(37,38)5-4-27)35-21(36)14-3-2-12(6-16(14)23(32,33)34)19(28)9-15(22(29,30)31)13-7-17(24)20(26)18(25)8-13/h2-3,6-9,11,15H,4-5,10H2,1H3,(H,35,36)/b19-9- |
| InChIKey | CYLRBSSVGGOCPI-OCKHKDLRSA-N |
| XLogP | 7.82 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.81 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|