C25H19ClF13NO3S — CID 130237278
4-[(Z)-3-[3-chloro-4-(2,2,2-trifluoroethyl)phenyl]-1,4,4,4-tetrafluorobut-1-enyl]-N-[(2R)-1-(2,2,2-trifluoroethylsulfonyl)propan-2-yl]-2-(trifluoromethyl)benzamide (PubChem CID 130237278) has the molecular formula C25H19ClF13NO3S and a molecular weight of 695.93 g/mol. Its IUPAC name is 4-[(Z)-3-[3-chloro-4-(2,2,2-trifluoroethyl)phenyl]-1,4,4,4-tetrafluorobut-1-enyl]-N-[(2R)-1-(2,2,2-trifluoroethylsulfonyl)propan-2-yl]-2-(trifluoromethyl)benzamide.
| Compound Name | 4-[(Z)-3-[3-chloro-4-(2,2,2-trifluoroethyl)phenyl]-1,4,4,4-tetrafluorobut-1-enyl]-N-[(2R)-1-(2,2,2-trifluoroethylsulfonyl)propan-2-yl]-2-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 130237278 |
| Molecular Formula | C25H19ClF13NO3S |
| Molecular Weight | 695.93 g/mol |
| Exact Mass | 695.06 |
| IUPAC Name | 4-[(Z)-3-[3-chloro-4-(2,2,2-trifluoroethyl)phenyl]-1,4,4,4-tetrafluorobut-1-enyl]-N-[(2R)-1-(2,2,2-trifluoroethylsulfonyl)propan-2-yl]-2-(trifluoromethyl)benzamide |
| SMILES | C[C@H](CS(=O)(=O)CC(F)(F)F)NC(=O)c1ccc(/C(F)=C/C(c2ccc(CC(F)(F)F)c(Cl)c2)C(F)(F)F)cc1C(F)(F)F |
| InChI | InChI=1S/C25H19ClF13NO3S/c1-12(10-44(42,43)11-23(31,32)33)40-21(41)16-5-4-14(6-18(16)25(37,38)39)20(27)8-17(24(34,35)36)13-2-3-15(19(26)7-13)9-22(28,29)30/h2-8,12,17H,9-11H2,1H3,(H,40,41)/b20-8-/t12-,17?/m1/s1 |
| InChIKey | SCYDORXIBDWFQM-BEVOVAIBSA-N |
| XLogP | 8.22 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.93 |
| LogP ≤ 5 | 8.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |