C23H17Br2F10NO3S — CID 130237427
4-[(Z)-3-(3,4-dibromophenyl)-1,4,4,4-tetrafluorobut-1-enyl]-N-[(2R)-1-(2,2,2-trifluoroethylsulfonyl)propan-2-yl]-2-(trifluoromethyl)benzamide (PubChem CID 130237427) has the molecular formula C23H17Br2F10NO3S and a molecular weight of 737.25 g/mol. Its IUPAC name is 4-[(Z)-3-(3,4-dibromophenyl)-1,4,4,4-tetrafluorobut-1-enyl]-N-[(2R)-1-(2,2,2-trifluoroethylsulfonyl)propan-2-yl]-2-(trifluoromethyl)benzamide.
| Compound Name | 4-[(Z)-3-(3,4-dibromophenyl)-1,4,4,4-tetrafluorobut-1-enyl]-N-[(2R)-1-(2,2,2-trifluoroethylsulfonyl)propan-2-yl]-2-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 130237427 |
| Molecular Formula | C23H17Br2F10NO3S |
| Molecular Weight | 737.25 g/mol |
| Exact Mass | 734.91 |
| IUPAC Name | 4-[(Z)-3-(3,4-dibromophenyl)-1,4,4,4-tetrafluorobut-1-enyl]-N-[(2R)-1-(2,2,2-trifluoroethylsulfonyl)propan-2-yl]-2-(trifluoromethyl)benzamide |
| SMILES | C[C@H](CS(=O)(=O)CC(F)(F)F)NC(=O)c1ccc(/C(F)=C/C(c2ccc(Br)c(Br)c2)C(F)(F)F)cc1C(F)(F)F |
| InChI | InChI=1S/C23H17Br2F10NO3S/c1-11(9-40(38,39)10-21(27,28)29)36-20(37)14-4-2-13(6-16(14)23(33,34)35)19(26)8-15(22(30,31)32)12-3-5-17(24)18(25)7-12/h2-8,11,15H,9-10H2,1H3,(H,36,37)/b19-8-/t11-,15?/m1/s1 |
| InChIKey | QTIKUYLOMURQPU-LWTPFMNXSA-N |
| XLogP | 7.98 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 737.25 |
| LogP ≤ 5 | 7.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |