C24H17Cl2F12NO3S — CID 130237468
4-[(Z)-3-[3,4-dichloro-5-(difluoromethyl)phenyl]-1,4,4,4-tetrafluorobut-1-enyl]-N-[1-(2,2,2-trifluoroethylsulfonyl)propan-2-yl]-2-(trifluoromethyl)benzamide (PubChem CID 130237468) has the molecular formula C24H17Cl2F12NO3S and a molecular weight of 698.35 g/mol. Its IUPAC name is 4-[(Z)-3-[3,4-dichloro-5-(difluoromethyl)phenyl]-1,4,4,4-tetrafluorobut-1-enyl]-N-[1-(2,2,2-trifluoroethylsulfonyl)propan-2-yl]-2-(trifluoromethyl)benzamide.
| Compound Name | 4-[(Z)-3-[3,4-dichloro-5-(difluoromethyl)phenyl]-1,4,4,4-tetrafluorobut-1-enyl]-N-[1-(2,2,2-trifluoroethylsulfonyl)propan-2-yl]-2-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 130237468 |
| Molecular Formula | C24H17Cl2F12NO3S |
| Molecular Weight | 698.35 g/mol |
| Exact Mass | 697.01 |
| IUPAC Name | 4-[(Z)-3-[3,4-dichloro-5-(difluoromethyl)phenyl]-1,4,4,4-tetrafluorobut-1-enyl]-N-[1-(2,2,2-trifluoroethylsulfonyl)propan-2-yl]-2-(trifluoromethyl)benzamide |
| SMILES | CC(CS(=O)(=O)CC(F)(F)F)NC(=O)c1ccc(/C(F)=C/C(c2cc(Cl)c(Cl)c(C(F)F)c2)C(F)(F)F)cc1C(F)(F)F |
| InChI | InChI=1S/C24H17Cl2F12NO3S/c1-10(8-43(41,42)9-22(30,31)32)39-21(40)13-3-2-11(5-16(13)24(36,37)38)18(27)7-15(23(33,34)35)12-4-14(20(28)29)19(26)17(25)6-12/h2-7,10,15,20H,8-9H2,1H3,(H,39,40)/b18-7- |
| InChIKey | LIOXNCWBQUZZSI-WSVATBPTSA-N |
| XLogP | 8.70 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.35 |
| LogP ≤ 5 | 8.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |