C24H17ClF12N2O2 — CID 130237102
4-[(Z)-3-[3-chloro-5-(difluoromethyl)phenyl]-1,4,4,4-tetrafluorobut-1-enyl]-N-[(2R)-1-oxo-1-(2,2,2-trifluoroethylamino)propan-2-yl]-2-(trifluoromethyl)benzamide (PubChem CID 130237102) has the molecular formula C24H17ClF12N2O2 and a molecular weight of 628.84 g/mol. Its IUPAC name is 4-[(Z)-3-[3-chloro-5-(difluoromethyl)phenyl]-1,4,4,4-tetrafluorobut-1-enyl]-N-[(2R)-1-oxo-1-(2,2,2-trifluoroethylamino)propan-2-yl]-2-(trifluoromethyl)benzamide.
| Compound Name | 4-[(Z)-3-[3-chloro-5-(difluoromethyl)phenyl]-1,4,4,4-tetrafluorobut-1-enyl]-N-[(2R)-1-oxo-1-(2,2,2-trifluoroethylamino)propan-2-yl]-2-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 130237102 |
| Molecular Formula | C24H17ClF12N2O2 |
| Molecular Weight | 628.84 g/mol |
| Exact Mass | 628.08 |
| IUPAC Name | 4-[(Z)-3-[3-chloro-5-(difluoromethyl)phenyl]-1,4,4,4-tetrafluorobut-1-enyl]-N-[(2R)-1-oxo-1-(2,2,2-trifluoroethylamino)propan-2-yl]-2-(trifluoromethyl)benzamide |
| SMILES | C[C@@H](NC(=O)c1ccc(/C(F)=C/C(c2cc(Cl)cc(C(F)F)c2)C(F)(F)F)cc1C(F)(F)F)C(=O)NCC(F)(F)F |
| InChI | InChI=1S/C24H17ClF12N2O2/c1-10(20(40)38-9-22(29,30)31)39-21(41)15-3-2-11(7-17(15)24(35,36)37)18(26)8-16(23(32,33)34)12-4-13(19(27)28)6-14(25)5-12/h2-8,10,16,19H,9H2,1H3,(H,38,40)(H,39,41)/b18-8-/t10-,16?/m1/s1 |
| InChIKey | SIZNBQQBRNJHGN-NJVYTKQGSA-N |
| XLogP | 7.75 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.84 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |