C30H28F10N2O2 — CID 130273582
4-[(Z)-3-[3-(3,3-dimethylbut-1-ynyl)-5-methylphenyl]-1,4,4,4-tetrafluorobut-1-enyl]-N-[(2R)-1-oxo-1-(2,2,2-trifluoroethylamino)propan-2-yl]-2-(trifluoromethyl)benzamide (PubChem CID 130273582) has the molecular formula C30H28F10N2O2 and a molecular weight of 638.55 g/mol. Its IUPAC name is 4-[(Z)-3-[3-(3,3-dimethylbut-1-ynyl)-5-methylphenyl]-1,4,4,4-tetrafluorobut-1-enyl]-N-[(2R)-1-oxo-1-(2,2,2-trifluoroethylamino)propan-2-yl]-2-(trifluoromethyl)benzamide.
| Compound Name | 4-[(Z)-3-[3-(3,3-dimethylbut-1-ynyl)-5-methylphenyl]-1,4,4,4-tetrafluorobut-1-enyl]-N-[(2R)-1-oxo-1-(2,2,2-trifluoroethylamino)propan-2-yl]-2-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 130273582 |
| Molecular Formula | C30H28F10N2O2 |
| Molecular Weight | 638.55 g/mol |
| Exact Mass | 638.20 |
| IUPAC Name | 4-[(Z)-3-[3-(3,3-dimethylbut-1-ynyl)-5-methylphenyl]-1,4,4,4-tetrafluorobut-1-enyl]-N-[(2R)-1-oxo-1-(2,2,2-trifluoroethylamino)propan-2-yl]-2-(trifluoromethyl)benzamide |
| SMILES | Cc1cc(C#CC(C)(C)C)cc(C(/C=C(\F)c2ccc(C(=O)N[C@H](C)C(=O)NCC(F)(F)F)c(C(F)(F)F)c2)C(F)(F)F)c1 |
| InChI | InChI=1S/C30H28F10N2O2/c1-16-10-18(8-9-27(3,4)5)12-20(11-16)22(29(35,36)37)14-24(31)19-6-7-21(23(13-19)30(38,39)40)26(44)42-17(2)25(43)41-15-28(32,33)34/h6-7,10-14,17,22H,15H2,1-5H3,(H,41,43)(H,42,44)/b24-14-/t17-,22?/m1/s1 |
| InChIKey | GHPANMLCVTWEBT-MQCIMKIBSA-N |
| XLogP | 7.86 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.55 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|