C25H18ClF13N2O2 — CID 130236764
4-[(Z)-3-[3-chloro-5-(2,2,2-trifluoroethyl)phenyl]-1,4,4,4-tetrafluorobut-1-enyl]-N-[(2R)-1-oxo-1-(2,2,2-trifluoroethylamino)propan-2-yl]-2-(trifluoromethyl)benzamide (PubChem CID 130236764) has the molecular formula C25H18ClF13N2O2 and a molecular weight of 660.86 g/mol. Its IUPAC name is 4-[(Z)-3-[3-chloro-5-(2,2,2-trifluoroethyl)phenyl]-1,4,4,4-tetrafluorobut-1-enyl]-N-[(2R)-1-oxo-1-(2,2,2-trifluoroethylamino)propan-2-yl]-2-(trifluoromethyl)benzamide.
| Compound Name | 4-[(Z)-3-[3-chloro-5-(2,2,2-trifluoroethyl)phenyl]-1,4,4,4-tetrafluorobut-1-enyl]-N-[(2R)-1-oxo-1-(2,2,2-trifluoroethylamino)propan-2-yl]-2-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 130236764 |
| Molecular Formula | C25H18ClF13N2O2 |
| Molecular Weight | 660.86 g/mol |
| Exact Mass | 660.08 |
| IUPAC Name | 4-[(Z)-3-[3-chloro-5-(2,2,2-trifluoroethyl)phenyl]-1,4,4,4-tetrafluorobut-1-enyl]-N-[(2R)-1-oxo-1-(2,2,2-trifluoroethylamino)propan-2-yl]-2-(trifluoromethyl)benzamide |
| SMILES | C[C@@H](NC(=O)c1ccc(/C(F)=C/C(c2cc(Cl)cc(CC(F)(F)F)c2)C(F)(F)F)cc1C(F)(F)F)C(=O)NCC(F)(F)F |
| InChI | InChI=1S/C25H18ClF13N2O2/c1-11(20(42)40-10-23(31,32)33)41-21(43)16-3-2-13(7-18(16)25(37,38)39)19(27)8-17(24(34,35)36)14-4-12(5-15(26)6-14)9-22(28,29)30/h2-8,11,17H,9-10H2,1H3,(H,40,42)(H,41,43)/b19-8-/t11-,17?/m1/s1 |
| InChIKey | NUKSEORPQMLXAC-MCMBUVEWSA-N |
| XLogP | 7.92 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.86 |
| LogP ≤ 5 | 7.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |