C24H20ClF9N2O3 — CID 163686495
4-[(Z)-3-(3-chloro-5-hydroxyphenyl)-1,4,4-trifluoropent-1-enyl]-N-[(2R)-1-oxo-1-(2,2,2-trifluoroethylamino)propan-2-yl]-2-(trifluoromethyl)benzamide (PubChem CID 163686495) has the molecular formula C24H20ClF9N2O3 and a molecular weight of 590.87 g/mol. Its IUPAC name is 4-[(Z)-3-(3-chloro-5-hydroxyphenyl)-1,4,4-trifluoropent-1-enyl]-N-[(2R)-1-oxo-1-(2,2,2-trifluoroethylamino)propan-2-yl]-2-(trifluoromethyl)benzamide.
| Compound Name | 4-[(Z)-3-(3-chloro-5-hydroxyphenyl)-1,4,4-trifluoropent-1-enyl]-N-[(2R)-1-oxo-1-(2,2,2-trifluoroethylamino)propan-2-yl]-2-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 163686495 |
| Molecular Formula | C24H20ClF9N2O3 |
| Molecular Weight | 590.87 g/mol |
| Exact Mass | 590.10 |
| IUPAC Name | 4-[(Z)-3-(3-chloro-5-hydroxyphenyl)-1,4,4-trifluoropent-1-enyl]-N-[(2R)-1-oxo-1-(2,2,2-trifluoroethylamino)propan-2-yl]-2-(trifluoromethyl)benzamide |
| SMILES | C[C@@H](NC(=O)c1ccc(/C(F)=C/C(c2cc(O)cc(Cl)c2)C(C)(F)F)cc1C(F)(F)F)C(=O)NCC(F)(F)F |
| InChI | InChI=1S/C24H20ClF9N2O3/c1-11(20(38)35-10-23(29,30)31)36-21(39)16-4-3-12(7-18(16)24(32,33)34)19(26)9-17(22(2,27)28)13-5-14(25)8-15(37)6-13/h3-9,11,17,37H,10H2,1-2H3,(H,35,38)(H,36,39)/b19-9-/t11-,17?/m1/s1 |
| InChIKey | JPHWIVZQIUQZSQ-XSPOLXFUSA-N |
| XLogP | 6.61 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.87 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |