C24H20Cl2F9NOS — CID 130237289
4-[(Z)-3-(3,4-dichlorophenyl)-1,4,4-trifluoropent-1-enyl]-N-[1-(2,2,2-trifluoroethylsulfanyl)propan-2-yl]-2-(trifluoromethyl)benzamide (PubChem CID 130237289) has the molecular formula C24H20Cl2F9NOS and a molecular weight of 612.39 g/mol. Its IUPAC name is 4-[(Z)-3-(3,4-dichlorophenyl)-1,4,4-trifluoropent-1-enyl]-N-[1-(2,2,2-trifluoroethylsulfanyl)propan-2-yl]-2-(trifluoromethyl)benzamide.
| Compound Name | 4-[(Z)-3-(3,4-dichlorophenyl)-1,4,4-trifluoropent-1-enyl]-N-[1-(2,2,2-trifluoroethylsulfanyl)propan-2-yl]-2-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 130237289 |
| Molecular Formula | C24H20Cl2F9NOS |
| Molecular Weight | 612.39 g/mol |
| Exact Mass | 611.05 |
| IUPAC Name | 4-[(Z)-3-(3,4-dichlorophenyl)-1,4,4-trifluoropent-1-enyl]-N-[1-(2,2,2-trifluoroethylsulfanyl)propan-2-yl]-2-(trifluoromethyl)benzamide |
| SMILES | CC(CSCC(F)(F)F)NC(=O)c1ccc(/C(F)=C/C(c2ccc(Cl)c(Cl)c2)C(C)(F)F)cc1C(F)(F)F |
| InChI | InChI=1S/C24H20Cl2F9NOS/c1-12(10-38-11-23(30,31)32)36-21(37)15-5-3-14(7-17(15)24(33,34)35)20(27)9-16(22(2,28)29)13-4-6-18(25)19(26)8-13/h3-9,12,16H,10-11H2,1-2H3,(H,36,37)/b20-9- |
| InChIKey | CFXKCXZJQXYVPX-UKWGHVSLSA-N |
| XLogP | 9.18 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.39 |
| LogP ≤ 5 | 9.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |