C25H21Cl3F9NO2S — CID 130236455
4-[(E)-1-ethoxy-4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]-N-[(2R)-1-(2,2,2-trifluoroethylsulfanyl)propan-2-yl]-2-(trifluoromethyl)benzamide (PubChem CID 130236455) has the molecular formula C25H21Cl3F9NO2S and a molecular weight of 676.86 g/mol. Its IUPAC name is 4-[(E)-1-ethoxy-4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]-N-[(2R)-1-(2,2,2-trifluoroethylsulfanyl)propan-2-yl]-2-(trifluoromethyl)benzamide.
| Compound Name | 4-[(E)-1-ethoxy-4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]-N-[(2R)-1-(2,2,2-trifluoroethylsulfanyl)propan-2-yl]-2-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 130236455 |
| Molecular Formula | C25H21Cl3F9NO2S |
| Molecular Weight | 676.86 g/mol |
| Exact Mass | 675.02 |
| IUPAC Name | 4-[(E)-1-ethoxy-4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]-N-[(2R)-1-(2,2,2-trifluoroethylsulfanyl)propan-2-yl]-2-(trifluoromethyl)benzamide |
| SMILES | CCO/C(=C/C(c1cc(Cl)c(Cl)c(Cl)c1)C(F)(F)F)c1ccc(C(=O)N[C@H](C)CSCC(F)(F)F)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C25H21Cl3F9NO2S/c1-3-40-20(9-16(24(32,33)34)14-7-18(26)21(28)19(27)8-14)13-4-5-15(17(6-13)25(35,36)37)22(39)38-12(2)10-41-11-23(29,30)31/h4-9,12,16H,3,10-11H2,1-2H3,(H,38,39)/b20-9+/t12-,16?/m1/s1 |
| InChIKey | DAZCMQGBGOYNGX-OPBNVMERSA-N |
| XLogP | 9.80 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.86 |
| LogP ≤ 5 | 9.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|