C23H18Cl3F8NOS — CID 130236494
2-(difluoromethyl)-N-[1-(2,2,2-trifluoroethylsulfanyl)propan-2-yl]-4-[(E)-4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]benzamide (PubChem CID 130236494) has the molecular formula C23H18Cl3F8NOS and a molecular weight of 614.81 g/mol. Its IUPAC name is 2-(difluoromethyl)-N-[1-(2,2,2-trifluoroethylsulfanyl)propan-2-yl]-4-[(E)-4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]benzamide.
| Compound Name | 2-(difluoromethyl)-N-[1-(2,2,2-trifluoroethylsulfanyl)propan-2-yl]-4-[(E)-4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]benzamide |
|---|---|
| PubChem CID | 130236494 |
| Molecular Formula | C23H18Cl3F8NOS |
| Molecular Weight | 614.81 g/mol |
| Exact Mass | 613.00 |
| IUPAC Name | 2-(difluoromethyl)-N-[1-(2,2,2-trifluoroethylsulfanyl)propan-2-yl]-4-[(E)-4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]benzamide |
| SMILES | CC(CSCC(F)(F)F)NC(=O)c1ccc(/C=C/C(c2cc(Cl)c(Cl)c(Cl)c2)C(F)(F)F)cc1C(F)F |
| InChI | InChI=1S/C23H18Cl3F8NOS/c1-11(9-37-10-22(29,30)31)35-21(36)14-4-2-12(6-15(14)20(27)28)3-5-16(23(32,33)34)13-7-17(24)19(26)18(25)8-13/h2-8,11,16,20H,9-10H2,1H3,(H,35,36)/b5-3+ |
| InChIKey | ZMFDCEQYDRYZSP-HWKANZROSA-N |
| XLogP | 9.36 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.81 |
| LogP ≤ 5 | 9.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|