C26H22Cl3F6NO2 — CID 157406302
N-[(Z,2R)-5-methyl-4-oxohept-5-en-2-yl]-2-(trifluoromethyl)-4-[(E)-4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]benzamide (PubChem CID 157406302) has the molecular formula C26H22Cl3F6NO2 and a molecular weight of 600.81 g/mol. Its IUPAC name is N-[(Z,2R)-5-methyl-4-oxohept-5-en-2-yl]-2-(trifluoromethyl)-4-[(E)-4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]benzamide.
| Compound Name | N-[(Z,2R)-5-methyl-4-oxohept-5-en-2-yl]-2-(trifluoromethyl)-4-[(E)-4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]benzamide |
|---|---|
| PubChem CID | 157406302 |
| Molecular Formula | C26H22Cl3F6NO2 |
| Molecular Weight | 600.81 g/mol |
| Exact Mass | 599.06 |
| IUPAC Name | N-[(Z,2R)-5-methyl-4-oxohept-5-en-2-yl]-2-(trifluoromethyl)-4-[(E)-4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]benzamide |
| SMILES | C/C=C(/C)C(=O)C[C@@H](C)NC(=O)c1ccc(/C=C/C(c2cc(Cl)c(Cl)c(Cl)c2)C(F)(F)F)cc1C(F)(F)F |
| InChI | InChI=1S/C26H22Cl3F6NO2/c1-4-13(2)22(37)9-14(3)36-24(38)17-7-5-15(10-19(17)26(33,34)35)6-8-18(25(30,31)32)16-11-20(27)23(29)21(28)12-16/h4-8,10-12,14,18H,9H2,1-3H3,(H,36,38)/b8-6+,13-4-/t14-,18?/m1/s1 |
| InChIKey | BNTFVJXGTPWILA-NOWMIZSWSA-N |
| XLogP | 9.07 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.81 |
| LogP ≤ 5 | 9.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|