C24H19Cl3F6N2O2 — CID 118555634
N-[(1R)-1-(cyclopropanecarbonylamino)ethyl]-2-(trifluoromethyl)-4-[(E)-4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]benzamide (PubChem CID 118555634) has the molecular formula C24H19Cl3F6N2O2 and a molecular weight of 587.78 g/mol. Its IUPAC name is N-[(1R)-1-(cyclopropanecarbonylamino)ethyl]-2-(trifluoromethyl)-4-[(E)-4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]benzamide.
| Compound Name | N-[(1R)-1-(cyclopropanecarbonylamino)ethyl]-2-(trifluoromethyl)-4-[(E)-4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]benzamide |
|---|---|
| PubChem CID | 118555634 |
| Molecular Formula | C24H19Cl3F6N2O2 |
| Molecular Weight | 587.78 g/mol |
| Exact Mass | 586.04 |
| IUPAC Name | N-[(1R)-1-(cyclopropanecarbonylamino)ethyl]-2-(trifluoromethyl)-4-[(E)-4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]benzamide |
| SMILES | C[C@@H](NC(=O)c1ccc(/C=C/C(c2cc(Cl)c(Cl)c(Cl)c2)C(F)(F)F)cc1C(F)(F)F)NC(=O)C1CC1 |
| InChI | InChI=1S/C24H19Cl3F6N2O2/c1-11(34-21(36)13-4-5-13)35-22(37)15-6-2-12(8-17(15)24(31,32)33)3-7-16(23(28,29)30)14-9-18(25)20(27)19(26)10-14/h2-3,6-11,13,16H,4-5H2,1H3,(H,34,36)(H,35,37)/b7-3+/t11-,16?/m1/s1 |
| InChIKey | SIBFWEPNYADCBI-VIJHKPKSSA-N |
| XLogP | 7.63 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.78 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|