C25H16Cl3F12NO2 — CID 147653285
N-(1,1,1,3,3,3-hexafluoropropan-2-yl)-2-methyl-4-oxo-4-[2-(trifluoromethyl)-4-[(E)-4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]phenyl]butanamide (PubChem CID 147653285) has the molecular formula C25H16Cl3F12NO2 and a molecular weight of 696.74 g/mol. Its IUPAC name is N-(1,1,1,3,3,3-hexafluoropropan-2-yl)-2-methyl-4-oxo-4-[2-(trifluoromethyl)-4-[(E)-4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]phenyl]butanamide.
| Compound Name | N-(1,1,1,3,3,3-hexafluoropropan-2-yl)-2-methyl-4-oxo-4-[2-(trifluoromethyl)-4-[(E)-4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]phenyl]butanamide |
|---|---|
| PubChem CID | 147653285 |
| Molecular Formula | C25H16Cl3F12NO2 |
| Molecular Weight | 696.74 g/mol |
| Exact Mass | 695.01 |
| IUPAC Name | N-(1,1,1,3,3,3-hexafluoropropan-2-yl)-2-methyl-4-oxo-4-[2-(trifluoromethyl)-4-[(E)-4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]phenyl]butanamide |
| SMILES | CC(CC(=O)c1ccc(/C=C/C(c2cc(Cl)c(Cl)c(Cl)c2)C(F)(F)F)cc1C(F)(F)F)C(=O)NC(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C25H16Cl3F12NO2/c1-10(20(43)41-21(24(35,36)37)25(38,39)40)6-18(42)13-4-2-11(7-15(13)23(32,33)34)3-5-14(22(29,30)31)12-8-16(26)19(28)17(27)9-12/h2-5,7-10,14,21H,6H2,1H3,(H,41,43)/b5-3+ |
| InChIKey | GJXUPEREOGFAHH-HWKANZROSA-N |
| XLogP | 9.84 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.74 |
| LogP ≤ 5 | 9.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|