C26H22Cl3F9O2S — CID 158822061
(3R)-4-methyl-3-(2,2,2-trifluoroethylsulfinylmethyl)-1-[2-(trifluoromethyl)-4-[(E)-4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]phenyl]pentan-1-one (PubChem CID 158822061) has the molecular formula C26H22Cl3F9O2S and a molecular weight of 675.87 g/mol. Its IUPAC name is (3R)-4-methyl-3-(2,2,2-trifluoroethylsulfinylmethyl)-1-[2-(trifluoromethyl)-4-[(E)-4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]phenyl]pentan-1-one.
| Compound Name | (3R)-4-methyl-3-(2,2,2-trifluoroethylsulfinylmethyl)-1-[2-(trifluoromethyl)-4-[(E)-4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]phenyl]pentan-1-one |
|---|---|
| PubChem CID | 158822061 |
| Molecular Formula | C26H22Cl3F9O2S |
| Molecular Weight | 675.87 g/mol |
| Exact Mass | 674.03 |
| IUPAC Name | (3R)-4-methyl-3-(2,2,2-trifluoroethylsulfinylmethyl)-1-[2-(trifluoromethyl)-4-[(E)-4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]phenyl]pentan-1-one |
| SMILES | CC(C)C(CC(=O)c1ccc(/C=C/C(c2cc(Cl)c(Cl)c(Cl)c2)C(F)(F)F)cc1C(F)(F)F)CS(=O)CC(F)(F)F |
| InChI | InChI=1S/C26H22Cl3F9O2S/c1-13(2)16(11-41(40)12-24(30,31)32)10-22(39)17-5-3-14(7-19(17)26(36,37)38)4-6-18(25(33,34)35)15-8-20(27)23(29)21(28)9-15/h3-9,13,16,18H,10-12H2,1-2H3/b6-4+ |
| InChIKey | IVZNBVSOSPSVRO-GQCTYLIASA-N |
| XLogP | 10.18 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.87 |
| LogP ≤ 5 | 10.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|