C24H17Cl2F9N2O2S — CID 130236608
4-[(E)-3-(3,5-dichloro-4-cyanophenyl)-4,4,4-trifluorobut-1-enyl]-N-[(2R)-1-(2,2,2-trifluoroethylsulfinyl)propan-2-yl]-2-(trifluoromethyl)benzamide (PubChem CID 130236608) has the molecular formula C24H17Cl2F9N2O2S and a molecular weight of 639.37 g/mol. Its IUPAC name is 4-[(E)-3-(3,5-dichloro-4-cyanophenyl)-4,4,4-trifluorobut-1-enyl]-N-[(2R)-1-(2,2,2-trifluoroethylsulfinyl)propan-2-yl]-2-(trifluoromethyl)benzamide.
| Compound Name | 4-[(E)-3-(3,5-dichloro-4-cyanophenyl)-4,4,4-trifluorobut-1-enyl]-N-[(2R)-1-(2,2,2-trifluoroethylsulfinyl)propan-2-yl]-2-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 130236608 |
| Molecular Formula | C24H17Cl2F9N2O2S |
| Molecular Weight | 639.37 g/mol |
| Exact Mass | 638.02 |
| IUPAC Name | 4-[(E)-3-(3,5-dichloro-4-cyanophenyl)-4,4,4-trifluorobut-1-enyl]-N-[(2R)-1-(2,2,2-trifluoroethylsulfinyl)propan-2-yl]-2-(trifluoromethyl)benzamide |
| SMILES | C[C@H](CS(=O)CC(F)(F)F)NC(=O)c1ccc(/C=C/C(c2cc(Cl)c(C#N)c(Cl)c2)C(F)(F)F)cc1C(F)(F)F |
| InChI | InChI=1S/C24H17Cl2F9N2O2S/c1-12(10-40(39)11-22(27,28)29)37-21(38)15-4-2-13(6-18(15)24(33,34)35)3-5-17(23(30,31)32)14-7-19(25)16(9-36)20(26)8-14/h2-8,12,17H,10-11H2,1H3,(H,37,38)/b5-3+/t12-,17?,40?/m1/s1 |
| InChIKey | PRPIDERMMGQJDA-CUKUJRBQSA-N |
| XLogP | 7.67 |
| TPSA | 69.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.37 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |