C23H17Br2ClF9NO2S — CID 130236675
4-[(E)-3-(3,5-dibromo-4-chlorophenyl)-4,4,4-trifluorobut-1-enyl]-N-[(2R)-1-(2,2,2-trifluoroethylsulfinyl)propan-2-yl]-2-(trifluoromethyl)benzamide (PubChem CID 130236675) has the molecular formula C23H17Br2ClF9NO2S and a molecular weight of 737.70 g/mol. Its IUPAC name is 4-[(E)-3-(3,5-dibromo-4-chlorophenyl)-4,4,4-trifluorobut-1-enyl]-N-[(2R)-1-(2,2,2-trifluoroethylsulfinyl)propan-2-yl]-2-(trifluoromethyl)benzamide.
| Compound Name | 4-[(E)-3-(3,5-dibromo-4-chlorophenyl)-4,4,4-trifluorobut-1-enyl]-N-[(2R)-1-(2,2,2-trifluoroethylsulfinyl)propan-2-yl]-2-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 130236675 |
| Molecular Formula | C23H17Br2ClF9NO2S |
| Molecular Weight | 737.70 g/mol |
| Exact Mass | 734.89 |
| IUPAC Name | 4-[(E)-3-(3,5-dibromo-4-chlorophenyl)-4,4,4-trifluorobut-1-enyl]-N-[(2R)-1-(2,2,2-trifluoroethylsulfinyl)propan-2-yl]-2-(trifluoromethyl)benzamide |
| SMILES | C[C@H](CS(=O)CC(F)(F)F)NC(=O)c1ccc(/C=C/C(c2cc(Br)c(Cl)c(Br)c2)C(F)(F)F)cc1C(F)(F)F |
| InChI | InChI=1S/C23H17Br2ClF9NO2S/c1-11(9-39(38)10-21(27,28)29)36-20(37)14-4-2-12(6-16(14)23(33,34)35)3-5-15(22(30,31)32)13-7-17(24)19(26)18(25)8-13/h2-8,11,15H,9-10H2,1H3,(H,36,37)/b5-3+/t11-,15?,39?/m1/s1 |
| InChIKey | VXNADKWYFVYIFP-UMHUECQZSA-N |
| XLogP | 8.67 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 737.70 |
| LogP ≤ 5 | 8.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|