C23H17Br2F9N2O2 — CID 90226695
4-[(E)-3-(3,5-dibromophenyl)-4,4,4-trifluorobut-1-enyl]-N-[2-oxo-2-(1,1,1-trifluoropropan-2-ylamino)ethyl]-2-(trifluoromethyl)benzamide (PubChem CID 90226695) has the molecular formula C23H17Br2F9N2O2 and a molecular weight of 684.19 g/mol. Its IUPAC name is 4-[(E)-3-(3,5-dibromophenyl)-4,4,4-trifluorobut-1-enyl]-N-[2-oxo-2-(1,1,1-trifluoropropan-2-ylamino)ethyl]-2-(trifluoromethyl)benzamide.
| Compound Name | 4-[(E)-3-(3,5-dibromophenyl)-4,4,4-trifluorobut-1-enyl]-N-[2-oxo-2-(1,1,1-trifluoropropan-2-ylamino)ethyl]-2-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 90226695 |
| Molecular Formula | C23H17Br2F9N2O2 |
| Molecular Weight | 684.19 g/mol |
| Exact Mass | 681.95 |
| IUPAC Name | 4-[(E)-3-(3,5-dibromophenyl)-4,4,4-trifluorobut-1-enyl]-N-[2-oxo-2-(1,1,1-trifluoropropan-2-ylamino)ethyl]-2-(trifluoromethyl)benzamide |
| SMILES | CC(NC(=O)CNC(=O)c1ccc(/C=C/C(c2cc(Br)cc(Br)c2)C(F)(F)F)cc1C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C23H17Br2F9N2O2/c1-11(21(26,27)28)36-19(37)10-35-20(38)16-4-2-12(6-18(16)23(32,33)34)3-5-17(22(29,30)31)13-7-14(24)9-15(25)8-13/h2-9,11,17H,10H2,1H3,(H,35,38)(H,36,37)/b5-3+ |
| InChIKey | ZSUUVUIENYMQNR-HWKANZROSA-N |
| XLogP | 7.39 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.19 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |