C23H16Cl2F10N2O2 — CID 118555641
4-[(E)-3-(3,5-dichloro-4-fluorophenyl)-4,4,4-trifluorobut-1-enyl]-2-(trifluoromethyl)-N-[(1R)-1-(3,3,3-trifluoropropanoylamino)ethyl]benzamide (PubChem CID 118555641) has the molecular formula C23H16Cl2F10N2O2 and a molecular weight of 613.28 g/mol. Its IUPAC name is 4-[(E)-3-(3,5-dichloro-4-fluorophenyl)-4,4,4-trifluorobut-1-enyl]-2-(trifluoromethyl)-N-[(1R)-1-(3,3,3-trifluoropropanoylamino)ethyl]benzamide.
| Compound Name | 4-[(E)-3-(3,5-dichloro-4-fluorophenyl)-4,4,4-trifluorobut-1-enyl]-2-(trifluoromethyl)-N-[(1R)-1-(3,3,3-trifluoropropanoylamino)ethyl]benzamide |
|---|---|
| PubChem CID | 118555641 |
| Molecular Formula | C23H16Cl2F10N2O2 |
| Molecular Weight | 613.28 g/mol |
| Exact Mass | 612.04 |
| IUPAC Name | 4-[(E)-3-(3,5-dichloro-4-fluorophenyl)-4,4,4-trifluorobut-1-enyl]-2-(trifluoromethyl)-N-[(1R)-1-(3,3,3-trifluoropropanoylamino)ethyl]benzamide |
| SMILES | CC(NC(=O)CC(F)(F)F)NC(=O)c1ccc(/C=C/C(c2cc(Cl)c(F)c(Cl)c2)C(F)(F)F)cc1C(F)(F)F |
| InChI | InChI=1S/C23H16Cl2F10N2O2/c1-10(36-18(38)9-21(27,28)29)37-20(39)13-4-2-11(6-15(13)23(33,34)35)3-5-14(22(30,31)32)12-7-16(24)19(26)17(25)8-12/h2-8,10,14H,9H2,1H3,(H,36,38)(H,37,39)/b5-3+ |
| InChIKey | XZCQCGZRIYJQKU-HWKANZROSA-N |
| XLogP | 7.66 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.28 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|