C18H9Cl2F7O2 — CID 123947113
4-[3-(3,5-dichloro-4-fluorophenyl)-4,4,4-trifluorobut-1-enyl]-2-(trifluoromethyl)benzoic acid (PubChem CID 123947113) has the molecular formula C18H9Cl2F7O2 and a molecular weight of 461.16 g/mol. Its IUPAC name is 4-[3-(3,5-dichloro-4-fluorophenyl)-4,4,4-trifluorobut-1-enyl]-2-(trifluoromethyl)benzoic acid.
| Compound Name | 4-[3-(3,5-dichloro-4-fluorophenyl)-4,4,4-trifluorobut-1-enyl]-2-(trifluoromethyl)benzoic acid |
|---|---|
| PubChem CID | 123947113 |
| Molecular Formula | C18H9Cl2F7O2 |
| Molecular Weight | 461.16 g/mol |
| Exact Mass | 459.99 |
| IUPAC Name | 4-[3-(3,5-dichloro-4-fluorophenyl)-4,4,4-trifluorobut-1-enyl]-2-(trifluoromethyl)benzoic acid |
| SMILES | O=C(O)c1ccc(C=CC(c2cc(Cl)c(F)c(Cl)c2)C(F)(F)F)cc1C(F)(F)F |
| InChI | InChI=1S/C18H9Cl2F7O2/c19-13-6-9(7-14(20)15(13)21)11(17(22,23)24)4-2-8-1-3-10(16(28)29)12(5-8)18(25,26)27/h1-7,11H,(H,28,29) |
| InChIKey | QPFNQEYVBUGPAD-UHFFFAOYSA-N |
| XLogP | 7.21 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.16 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|