C25H22Cl2F8N2O2 — CID 144976930
4-[(E)-3-(3,5-dichloro-4-fluorophenyl)-4,4,4-trifluorobut-1-enyl]-N-[(1R)-1-[(3-fluoro-3-methylbutanoyl)amino]ethyl]-2-(trifluoromethyl)benzamide (PubChem CID 144976930) has the molecular formula C25H22Cl2F8N2O2 and a molecular weight of 605.35 g/mol. Its IUPAC name is 4-[(E)-3-(3,5-dichloro-4-fluorophenyl)-4,4,4-trifluorobut-1-enyl]-N-[(1R)-1-[(3-fluoro-3-methylbutanoyl)amino]ethyl]-2-(trifluoromethyl)benzamide.
| Compound Name | 4-[(E)-3-(3,5-dichloro-4-fluorophenyl)-4,4,4-trifluorobut-1-enyl]-N-[(1R)-1-[(3-fluoro-3-methylbutanoyl)amino]ethyl]-2-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 144976930 |
| Molecular Formula | C25H22Cl2F8N2O2 |
| Molecular Weight | 605.35 g/mol |
| Exact Mass | 604.09 |
| IUPAC Name | 4-[(E)-3-(3,5-dichloro-4-fluorophenyl)-4,4,4-trifluorobut-1-enyl]-N-[(1R)-1-[(3-fluoro-3-methylbutanoyl)amino]ethyl]-2-(trifluoromethyl)benzamide |
| SMILES | CC(NC(=O)CC(C)(C)F)NC(=O)c1ccc(/C=C/C(c2cc(Cl)c(F)c(Cl)c2)C(F)(F)F)cc1C(F)(F)F |
| InChI | InChI=1S/C25H22Cl2F8N2O2/c1-12(36-20(38)11-23(2,3)29)37-22(39)15-6-4-13(8-17(15)25(33,34)35)5-7-16(24(30,31)32)14-9-18(26)21(28)19(27)10-14/h4-10,12,16H,11H2,1-3H3,(H,36,38)(H,37,39)/b7-5+ |
| InChIKey | BNQYWQATELGKEP-FNORWQNLSA-N |
| XLogP | 7.84 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.35 |
| LogP ≤ 5 | 7.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|