C24H19Cl3F9NO2S — CID 130236429
N-[(2R)-4-(2,2,2-trifluoroethylsulfinyl)butan-2-yl]-2-(trifluoromethyl)-4-[(E)-4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]benzamide (PubChem CID 130236429) has the molecular formula C24H19Cl3F9NO2S and a molecular weight of 662.83 g/mol. Its IUPAC name is N-[(2R)-4-(2,2,2-trifluoroethylsulfinyl)butan-2-yl]-2-(trifluoromethyl)-4-[(E)-4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]benzamide.
| Compound Name | N-[(2R)-4-(2,2,2-trifluoroethylsulfinyl)butan-2-yl]-2-(trifluoromethyl)-4-[(E)-4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]benzamide |
|---|---|
| PubChem CID | 130236429 |
| Molecular Formula | C24H19Cl3F9NO2S |
| Molecular Weight | 662.83 g/mol |
| Exact Mass | 661.01 |
| IUPAC Name | N-[(2R)-4-(2,2,2-trifluoroethylsulfinyl)butan-2-yl]-2-(trifluoromethyl)-4-[(E)-4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]benzamide |
| SMILES | C[C@H](CCS(=O)CC(F)(F)F)NC(=O)c1ccc(/C=C/C(c2cc(Cl)c(Cl)c(Cl)c2)C(F)(F)F)cc1C(F)(F)F |
| InChI | InChI=1S/C24H19Cl3F9NO2S/c1-12(6-7-40(39)11-22(28,29)30)37-21(38)15-4-2-13(8-17(15)24(34,35)36)3-5-16(23(31,32)33)14-9-18(25)20(27)19(26)10-14/h2-5,8-10,12,16H,6-7,11H2,1H3,(H,37,38)/b5-3+/t12-,16?,40?/m1/s1 |
| InChIKey | VSAOECMQMVBLEA-MPVFTKPVSA-N |
| XLogP | 8.84 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.83 |
| LogP ≤ 5 | 8.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|