C24H22Cl3F6NO2S — CID 130294587
2-ethyl-N-[1-(2,2,2-trifluoroethylsulfinyl)propan-2-yl]-4-[(E)-4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]benzamide (PubChem CID 130294587) has the molecular formula C24H22Cl3F6NO2S and a molecular weight of 608.86 g/mol. Its IUPAC name is 2-ethyl-N-[1-(2,2,2-trifluoroethylsulfinyl)propan-2-yl]-4-[(E)-4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]benzamide.
| Compound Name | 2-ethyl-N-[1-(2,2,2-trifluoroethylsulfinyl)propan-2-yl]-4-[(E)-4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]benzamide |
|---|---|
| PubChem CID | 130294587 |
| Molecular Formula | C24H22Cl3F6NO2S |
| Molecular Weight | 608.86 g/mol |
| Exact Mass | 607.03 |
| IUPAC Name | 2-ethyl-N-[1-(2,2,2-trifluoroethylsulfinyl)propan-2-yl]-4-[(E)-4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]benzamide |
| SMILES | CCc1cc(/C=C/C(c2cc(Cl)c(Cl)c(Cl)c2)C(F)(F)F)ccc1C(=O)NC(C)CS(=O)CC(F)(F)F |
| InChI | InChI=1S/C24H22Cl3F6NO2S/c1-3-15-8-14(4-6-17(15)22(35)34-13(2)11-37(36)12-23(28,29)30)5-7-18(24(31,32)33)16-9-19(25)21(27)20(26)10-16/h4-10,13,18H,3,11-12H2,1-2H3,(H,34,35)/b7-5+ |
| InChIKey | IYRORXGLBRPTGT-FNORWQNLSA-N |
| XLogP | 8.00 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.86 |
| LogP ≤ 5 | 8.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|