C24H19Br2F9N2O2 — CID 118555603
4-[(E)-3-(3,5-dibromophenyl)-4,4,4-trifluorobut-1-enyl]-N-[(1R)-1-(4,4,4-trifluorobutanoylamino)ethyl]-2-(trifluoromethyl)benzamide (PubChem CID 118555603) has the molecular formula C24H19Br2F9N2O2 and a molecular weight of 698.22 g/mol. Its IUPAC name is 4-[(E)-3-(3,5-dibromophenyl)-4,4,4-trifluorobut-1-enyl]-N-[(1R)-1-(4,4,4-trifluorobutanoylamino)ethyl]-2-(trifluoromethyl)benzamide.
| Compound Name | 4-[(E)-3-(3,5-dibromophenyl)-4,4,4-trifluorobut-1-enyl]-N-[(1R)-1-(4,4,4-trifluorobutanoylamino)ethyl]-2-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 118555603 |
| Molecular Formula | C24H19Br2F9N2O2 |
| Molecular Weight | 698.22 g/mol |
| Exact Mass | 695.97 |
| IUPAC Name | 4-[(E)-3-(3,5-dibromophenyl)-4,4,4-trifluorobut-1-enyl]-N-[(1R)-1-(4,4,4-trifluorobutanoylamino)ethyl]-2-(trifluoromethyl)benzamide |
| SMILES | C[C@H](NC(=O)CCC(F)(F)F)NC(=O)c1ccc(/C=C/C(c2cc(Br)cc(Br)c2)C(F)(F)F)cc1C(F)(F)F |
| InChI | InChI=1S/C24H19Br2F9N2O2/c1-12(36-20(38)6-7-22(27,28)29)37-21(39)17-4-2-13(8-19(17)24(33,34)35)3-5-18(23(30,31)32)14-9-15(25)11-16(26)10-14/h2-5,8-12,18H,6-7H2,1H3,(H,36,38)(H,37,39)/b5-3+/t12-,18?/m1/s1 |
| InChIKey | UMLCEGAQBQKFBR-GJEMJLPMSA-N |
| XLogP | 8.12 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.22 |
| LogP ≤ 5 | 8.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|