C26H16Cl3F7N2O — CID 90226997
N-[1-(6-chloro-3-pyridinyl)cyclopropyl]-4-[(E)-3-(3,5-dichloro-4-fluorophenyl)-4,4,4-trifluorobut-1-enyl]-2-(trifluoromethyl)benzamide (PubChem CID 90226997) has the molecular formula C26H16Cl3F7N2O and a molecular weight of 611.77 g/mol. Its IUPAC name is N-[1-(6-chloro-3-pyridinyl)cyclopropyl]-4-[(E)-3-(3,5-dichloro-4-fluorophenyl)-4,4,4-trifluorobut-1-enyl]-2-(trifluoromethyl)benzamide.
| Compound Name | N-[1-(6-chloro-3-pyridinyl)cyclopropyl]-4-[(E)-3-(3,5-dichloro-4-fluorophenyl)-4,4,4-trifluorobut-1-enyl]-2-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 90226997 |
| Molecular Formula | C26H16Cl3F7N2O |
| Molecular Weight | 611.77 g/mol |
| Exact Mass | 610.02 |
| IUPAC Name | N-[1-(6-chloro-3-pyridinyl)cyclopropyl]-4-[(E)-3-(3,5-dichloro-4-fluorophenyl)-4,4,4-trifluorobut-1-enyl]-2-(trifluoromethyl)benzamide |
| SMILES | O=C(NC1(c2ccc(Cl)nc2)CC1)c1ccc(/C=C/C(c2cc(Cl)c(F)c(Cl)c2)C(F)(F)F)cc1C(F)(F)F |
| InChI | InChI=1S/C26H16Cl3F7N2O/c27-19-10-14(11-20(28)22(19)30)17(25(31,32)33)5-2-13-1-4-16(18(9-13)26(34,35)36)23(39)38-24(7-8-24)15-3-6-21(29)37-12-15/h1-6,9-12,17H,7-8H2,(H,38,39)/b5-2+ |
| InChIKey | LQHIMXHNARNBRV-GORDUTHDSA-N |
| XLogP | 8.98 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.77 |
| LogP ≤ 5 | 8.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|