C24H16Cl3F9N2O2 — CID 90218115
N-[1-(2,2,2-trifluoroethylcarbamoyl)cyclopropyl]-2-(trifluoromethyl)-4-[(E,3S)-4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]benzamide (PubChem CID 90218115) has the molecular formula C24H16Cl3F9N2O2 and a molecular weight of 641.75 g/mol. Its IUPAC name is N-[1-(2,2,2-trifluoroethylcarbamoyl)cyclopropyl]-2-(trifluoromethyl)-4-[(E,3S)-4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]benzamide.
| Compound Name | N-[1-(2,2,2-trifluoroethylcarbamoyl)cyclopropyl]-2-(trifluoromethyl)-4-[(E,3S)-4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]benzamide |
|---|---|
| PubChem CID | 90218115 |
| Molecular Formula | C24H16Cl3F9N2O2 |
| Molecular Weight | 641.75 g/mol |
| Exact Mass | 640.01 |
| IUPAC Name | N-[1-(2,2,2-trifluoroethylcarbamoyl)cyclopropyl]-2-(trifluoromethyl)-4-[(E,3S)-4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]benzamide |
| SMILES | O=C(NC1(C(=O)NCC(F)(F)F)CC1)c1ccc(/C=C/[C@@H](c2cc(Cl)c(Cl)c(Cl)c2)C(F)(F)F)cc1C(F)(F)F |
| InChI | InChI=1S/C24H16Cl3F9N2O2/c25-16-8-12(9-17(26)18(16)27)14(23(31,32)33)4-2-11-1-3-13(15(7-11)24(34,35)36)19(39)38-21(5-6-21)20(40)37-10-22(28,29)30/h1-4,7-9,14H,5-6,10H2,(H,37,40)(H,38,39)/b4-2+/t14-/m0/s1 |
| InChIKey | JLEFXTAFVRMJTL-PMUGQKEBSA-N |
| XLogP | 7.97 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.75 |
| LogP ≤ 5 | 7.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|