C25H21Cl3F6N2O2 — CID 123674775
2-methyl-N-[1-(2,2,2-trifluoroethylcarbamoyl)cyclobutyl]-4-[4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]benzamide (PubChem CID 123674775) has the molecular formula C25H21Cl3F6N2O2 and a molecular weight of 601.80 g/mol. Its IUPAC name is 2-methyl-N-[1-(2,2,2-trifluoroethylcarbamoyl)cyclobutyl]-4-[4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]benzamide.
| Compound Name | 2-methyl-N-[1-(2,2,2-trifluoroethylcarbamoyl)cyclobutyl]-4-[4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]benzamide |
|---|---|
| PubChem CID | 123674775 |
| Molecular Formula | C25H21Cl3F6N2O2 |
| Molecular Weight | 601.80 g/mol |
| Exact Mass | 600.06 |
| IUPAC Name | 2-methyl-N-[1-(2,2,2-trifluoroethylcarbamoyl)cyclobutyl]-4-[4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]benzamide |
| SMILES | Cc1cc(C=CC(c2cc(Cl)c(Cl)c(Cl)c2)C(F)(F)F)ccc1C(=O)NC1(C(=O)NCC(F)(F)F)CCC1 |
| InChI | InChI=1S/C25H21Cl3F6N2O2/c1-13-9-14(4-6-17(25(32,33)34)15-10-18(26)20(28)19(27)11-15)3-5-16(13)21(37)36-23(7-2-8-23)22(38)35-12-24(29,30)31/h3-6,9-11,17H,2,7-8,12H2,1H3,(H,35,38)(H,36,37) |
| InChIKey | JETAZQYJTBWUKD-UHFFFAOYSA-N |
| XLogP | 7.65 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.80 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|