C24H19Cl3F6N2OS — CID 90227033
2-methyl-N-[1-(2,2,2-trifluoroethylcarbamothioyl)cyclopropyl]-4-[(E)-4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]benzamide (PubChem CID 90227033) has the molecular formula C24H19Cl3F6N2OS and a molecular weight of 603.84 g/mol. Its IUPAC name is 2-methyl-N-[1-(2,2,2-trifluoroethylcarbamothioyl)cyclopropyl]-4-[(E)-4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]benzamide.
| Compound Name | 2-methyl-N-[1-(2,2,2-trifluoroethylcarbamothioyl)cyclopropyl]-4-[(E)-4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]benzamide |
|---|---|
| PubChem CID | 90227033 |
| Molecular Formula | C24H19Cl3F6N2OS |
| Molecular Weight | 603.84 g/mol |
| Exact Mass | 602.02 |
| IUPAC Name | 2-methyl-N-[1-(2,2,2-trifluoroethylcarbamothioyl)cyclopropyl]-4-[(E)-4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]benzamide |
| SMILES | Cc1cc(/C=C/C(c2cc(Cl)c(Cl)c(Cl)c2)C(F)(F)F)ccc1C(=O)NC1(C(=S)NCC(F)(F)F)CC1 |
| InChI | InChI=1S/C24H19Cl3F6N2OS/c1-12-8-13(3-5-16(24(31,32)33)14-9-17(25)19(27)18(26)10-14)2-4-15(12)20(36)35-22(6-7-22)21(37)34-11-23(28,29)30/h2-5,8-10,16H,6-7,11H2,1H3,(H,34,37)(H,35,36)/b5-3+ |
| InChIKey | MVHCICKISAZTFJ-HWKANZROSA-N |
| XLogP | 8.06 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.84 |
| LogP ≤ 5 | 8.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|