C20H13Cl4F6N3OS — CID 123267167
1-[[2-chloro-4-[4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]benzoyl]amino]-3-(2,2,2-trifluoroethyl)thiourea (PubChem CID 123267167) has the molecular formula C20H13Cl4F6N3OS and a molecular weight of 599.21 g/mol. Its IUPAC name is 1-[[2-chloro-4-[4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]benzoyl]amino]-3-(2,2,2-trifluoroethyl)thiourea.
| Compound Name | 1-[[2-chloro-4-[4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]benzoyl]amino]-3-(2,2,2-trifluoroethyl)thiourea |
|---|---|
| PubChem CID | 123267167 |
| Molecular Formula | C20H13Cl4F6N3OS |
| Molecular Weight | 599.21 g/mol |
| Exact Mass | 596.94 |
| IUPAC Name | 1-[[2-chloro-4-[4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]benzoyl]amino]-3-(2,2,2-trifluoroethyl)thiourea |
| SMILES | O=C(NNC(=S)NCC(F)(F)F)c1ccc(C=CC(c2cc(Cl)c(Cl)c(Cl)c2)C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C20H13Cl4F6N3OS/c21-13-5-9(1-3-11(13)17(34)32-33-18(35)31-8-19(25,26)27)2-4-12(20(28,29)30)10-6-14(22)16(24)15(23)7-10/h1-7,12H,8H2,(H,32,34)(H2,31,33,35) |
| InChIKey | MVXSHNHUMLSTBT-UHFFFAOYSA-N |
| XLogP | 7.33 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.21 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|