C21H14Cl3F7N2O2 — CID 130207369
2-fluoro-N-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]-4-[(E)-4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]benzamide (PubChem CID 130207369) has the molecular formula C21H14Cl3F7N2O2 and a molecular weight of 565.70 g/mol. Its IUPAC name is 2-fluoro-N-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]-4-[(E)-4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]benzamide.
| Compound Name | 2-fluoro-N-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]-4-[(E)-4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]benzamide |
|---|---|
| PubChem CID | 130207369 |
| Molecular Formula | C21H14Cl3F7N2O2 |
| Molecular Weight | 565.70 g/mol |
| Exact Mass | 564.00 |
| IUPAC Name | 2-fluoro-N-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]-4-[(E)-4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]benzamide |
| SMILES | O=C(CNC(=O)c1ccc(/C=C/C(c2cc(Cl)c(Cl)c(Cl)c2)C(F)(F)F)cc1F)NCC(F)(F)F |
| InChI | InChI=1S/C21H14Cl3F7N2O2/c22-14-6-11(7-15(23)18(14)24)13(21(29,30)31)4-2-10-1-3-12(16(25)5-10)19(35)32-8-17(34)33-9-20(26,27)28/h1-7,13H,8-9H2,(H,32,35)(H,33,34)/b4-2+ |
| InChIKey | USYMJVAIGNOAFM-DUXPYHPUSA-N |
| XLogP | 6.55 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.70 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|