C25H18BrCl2F6N5O3 — CID 134217645
4-[(E)-3-[3-(4-amino-2-oxopyrimidin-1-yl)-4,5-dichlorophenyl]-4,4,4-trifluorobut-1-enyl]-2-bromo-N-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]benzamide (PubChem CID 134217645) has the molecular formula C25H18BrCl2F6N5O3 and a molecular weight of 701.25 g/mol. Its IUPAC name is 4-[(E)-3-[3-(4-amino-2-oxopyrimidin-1-yl)-4,5-dichlorophenyl]-4,4,4-trifluorobut-1-enyl]-2-bromo-N-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]benzamide.
| Compound Name | 4-[(E)-3-[3-(4-amino-2-oxopyrimidin-1-yl)-4,5-dichlorophenyl]-4,4,4-trifluorobut-1-enyl]-2-bromo-N-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]benzamide |
|---|---|
| PubChem CID | 134217645 |
| Molecular Formula | C25H18BrCl2F6N5O3 |
| Molecular Weight | 701.25 g/mol |
| Exact Mass | 698.99 |
| IUPAC Name | 4-[(E)-3-[3-(4-amino-2-oxopyrimidin-1-yl)-4,5-dichlorophenyl]-4,4,4-trifluorobut-1-enyl]-2-bromo-N-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]benzamide |
| SMILES | Nc1ccn(-c2cc(C(/C=C/c3ccc(C(=O)NCC(=O)NCC(F)(F)F)c(Br)c3)C(F)(F)F)cc(Cl)c2Cl)c(=O)n1 |
| InChI | InChI=1S/C25H18BrCl2F6N5O3/c26-16-7-12(1-3-14(16)22(41)36-10-20(40)37-11-24(29,30)31)2-4-15(25(32,33)34)13-8-17(27)21(28)18(9-13)39-6-5-19(35)38-23(39)42/h1-9,15H,10-11H2,(H,36,41)(H,37,40)(H2,35,38,42)/b4-2+ |
| InChIKey | MTLLBQZWFBQHHO-DUXPYHPUSA-N |
| XLogP | 5.65 |
| TPSA | 119.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 701.25 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |