C22H17BrF8N2O3 — CID 90226581
2-bromo-4-[(E)-3-(3,5-difluoro-4-methoxyphenyl)-4,4,4-trifluorobut-1-enyl]-N-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]benzamide (PubChem CID 90226581) has the molecular formula C22H17BrF8N2O3 and a molecular weight of 589.28 g/mol. Its IUPAC name is 2-bromo-4-[(E)-3-(3,5-difluoro-4-methoxyphenyl)-4,4,4-trifluorobut-1-enyl]-N-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]benzamide.
| Compound Name | 2-bromo-4-[(E)-3-(3,5-difluoro-4-methoxyphenyl)-4,4,4-trifluorobut-1-enyl]-N-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]benzamide |
|---|---|
| PubChem CID | 90226581 |
| Molecular Formula | C22H17BrF8N2O3 |
| Molecular Weight | 589.28 g/mol |
| Exact Mass | 588.03 |
| IUPAC Name | 2-bromo-4-[(E)-3-(3,5-difluoro-4-methoxyphenyl)-4,4,4-trifluorobut-1-enyl]-N-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]benzamide |
| SMILES | COc1c(F)cc(C(/C=C/c2ccc(C(=O)NCC(=O)NCC(F)(F)F)c(Br)c2)C(F)(F)F)cc1F |
| InChI | InChI=1S/C22H17BrF8N2O3/c1-36-19-16(24)7-12(8-17(19)25)14(22(29,30)31)5-3-11-2-4-13(15(23)6-11)20(35)32-9-18(34)33-10-21(26,27)28/h2-8,14H,9-10H2,1H3,(H,32,35)(H,33,34)/b5-3+ |
| InChIKey | BQUSHEJCQVTQDW-HWKANZROSA-N |
| XLogP | 5.50 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.28 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |