C28H31BrF6N2OS — CID 162570745
2-[[2-bromo-4-[(E)-4,4,4-trifluoro-3-(4-methyl-3,5-dipropylphenyl)but-1-enyl]benzenecarbothioyl]amino]-N-(2,2,2-trifluoroethyl)acetamide (PubChem CID 162570745) has the molecular formula C28H31BrF6N2OS and a molecular weight of 637.53 g/mol. Its IUPAC name is 2-[[2-bromo-4-[(E)-4,4,4-trifluoro-3-(4-methyl-3,5-dipropylphenyl)but-1-enyl]benzenecarbothioyl]amino]-N-(2,2,2-trifluoroethyl)acetamide.
| Compound Name | 2-[[2-bromo-4-[(E)-4,4,4-trifluoro-3-(4-methyl-3,5-dipropylphenyl)but-1-enyl]benzenecarbothioyl]amino]-N-(2,2,2-trifluoroethyl)acetamide |
|---|---|
| PubChem CID | 162570745 |
| Molecular Formula | C28H31BrF6N2OS |
| Molecular Weight | 637.53 g/mol |
| Exact Mass | 636.12 |
| IUPAC Name | 2-[[2-bromo-4-[(E)-4,4,4-trifluoro-3-(4-methyl-3,5-dipropylphenyl)but-1-enyl]benzenecarbothioyl]amino]-N-(2,2,2-trifluoroethyl)acetamide |
| SMILES | CCCc1cc(C(/C=C/c2ccc(C(=S)NCC(=O)NCC(F)(F)F)c(Br)c2)C(F)(F)F)cc(CCC)c1C |
| InChI | InChI=1S/C28H31BrF6N2OS/c1-4-6-19-13-21(14-20(7-5-2)17(19)3)23(28(33,34)35)11-9-18-8-10-22(24(29)12-18)26(39)36-15-25(38)37-16-27(30,31)32/h8-14,23H,4-7,15-16H2,1-3H3,(H,36,39)(H,37,38)/b11-9+ |
| InChIKey | IPLNOWBSDJHBIR-PKNBQFBNSA-N |
| XLogP | 7.97 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.53 |
| LogP ≤ 5 | 7.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|