C24H26BrF4N3OS — CID 162570948
2-bromo-N-[2-(ethylcarbamothioylamino)ethyl]-4-[(E)-4,4,4-trifluoro-3-(4-fluoro-3,5-dimethylphenyl)but-1-enyl]benzamide (PubChem CID 162570948) has the molecular formula C24H26BrF4N3OS and a molecular weight of 560.46 g/mol. Its IUPAC name is 2-bromo-N-[2-(ethylcarbamothioylamino)ethyl]-4-[(E)-4,4,4-trifluoro-3-(4-fluoro-3,5-dimethylphenyl)but-1-enyl]benzamide.
| Compound Name | 2-bromo-N-[2-(ethylcarbamothioylamino)ethyl]-4-[(E)-4,4,4-trifluoro-3-(4-fluoro-3,5-dimethylphenyl)but-1-enyl]benzamide |
|---|---|
| PubChem CID | 162570948 |
| Molecular Formula | C24H26BrF4N3OS |
| Molecular Weight | 560.46 g/mol |
| Exact Mass | 559.09 |
| IUPAC Name | 2-bromo-N-[2-(ethylcarbamothioylamino)ethyl]-4-[(E)-4,4,4-trifluoro-3-(4-fluoro-3,5-dimethylphenyl)but-1-enyl]benzamide |
| SMILES | CCNC(=S)NCCNC(=O)c1ccc(/C=C/C(c2cc(C)c(F)c(C)c2)C(F)(F)F)cc1Br |
| InChI | InChI=1S/C24H26BrF4N3OS/c1-4-30-23(34)32-10-9-31-22(33)18-7-5-16(13-20(18)25)6-8-19(24(27,28)29)17-11-14(2)21(26)15(3)12-17/h5-8,11-13,19H,4,9-10H2,1-3H3,(H,31,33)(H2,30,32,34)/b8-6+ |
| InChIKey | BSCCXKQGOQFCSQ-SOFGYWHQSA-N |
| XLogP | 5.78 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.46 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|