C20H14Br3F6N3O2 — CID 123903432
1-[[2-bromo-4-[3-(3,5-dibromophenyl)-4,4,4-trifluorobut-1-enyl]benzoyl]amino]-3-(2,2,2-trifluoroethyl)urea (PubChem CID 123903432) has the molecular formula C20H14Br3F6N3O2 and a molecular weight of 682.05 g/mol. Its IUPAC name is 1-[[2-bromo-4-[3-(3,5-dibromophenyl)-4,4,4-trifluorobut-1-enyl]benzoyl]amino]-3-(2,2,2-trifluoroethyl)urea.
| Compound Name | 1-[[2-bromo-4-[3-(3,5-dibromophenyl)-4,4,4-trifluorobut-1-enyl]benzoyl]amino]-3-(2,2,2-trifluoroethyl)urea |
|---|---|
| PubChem CID | 123903432 |
| Molecular Formula | C20H14Br3F6N3O2 |
| Molecular Weight | 682.05 g/mol |
| Exact Mass | 678.85 |
| IUPAC Name | 1-[[2-bromo-4-[3-(3,5-dibromophenyl)-4,4,4-trifluorobut-1-enyl]benzoyl]amino]-3-(2,2,2-trifluoroethyl)urea |
| SMILES | O=C(NCC(F)(F)F)NNC(=O)c1ccc(C=CC(c2cc(Br)cc(Br)c2)C(F)(F)F)cc1Br |
| InChI | InChI=1S/C20H14Br3F6N3O2/c21-12-6-11(7-13(22)8-12)15(20(27,28)29)4-2-10-1-3-14(16(23)5-10)17(33)31-32-18(34)30-9-19(24,25)26/h1-8,15H,9H2,(H,31,33)(H2,30,32,34) |
| InChIKey | LSYMYSVUUZWNIP-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.05 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|