C24H21Br2F6NO2 — CID 147844038
(2S)-4-[4-[(E)-3-(3,5-dibromophenyl)-4,4,4-trifluorobut-1-enyl]-2-methylphenyl]-2-methyl-4-oxo-N-(2,2,2-trifluoroethyl)butanamide (PubChem CID 147844038) has the molecular formula C24H21Br2F6NO2 and a molecular weight of 629.23 g/mol. Its IUPAC name is (2S)-4-[4-[(E)-3-(3,5-dibromophenyl)-4,4,4-trifluorobut-1-enyl]-2-methylphenyl]-2-methyl-4-oxo-N-(2,2,2-trifluoroethyl)butanamide.
| Compound Name | (2S)-4-[4-[(E)-3-(3,5-dibromophenyl)-4,4,4-trifluorobut-1-enyl]-2-methylphenyl]-2-methyl-4-oxo-N-(2,2,2-trifluoroethyl)butanamide |
|---|---|
| PubChem CID | 147844038 |
| Molecular Formula | C24H21Br2F6NO2 |
| Molecular Weight | 629.23 g/mol |
| Exact Mass | 626.98 |
| IUPAC Name | (2S)-4-[4-[(E)-3-(3,5-dibromophenyl)-4,4,4-trifluorobut-1-enyl]-2-methylphenyl]-2-methyl-4-oxo-N-(2,2,2-trifluoroethyl)butanamide |
| SMILES | Cc1cc(/C=C/C(c2cc(Br)cc(Br)c2)C(F)(F)F)ccc1C(=O)C[C@H](C)C(=O)NCC(F)(F)F |
| InChI | InChI=1S/C24H21Br2F6NO2/c1-13-7-15(4-6-20(24(30,31)32)16-9-17(25)11-18(26)10-16)3-5-19(13)21(34)8-14(2)22(35)33-12-23(27,28)29/h3-7,9-11,14,20H,8,12H2,1-2H3,(H,33,35)/b6-4+/t14-,20?/m0/s1 |
| InChIKey | HTNRIYXSBKTHLJ-SGRRASPYSA-N |
| XLogP | 7.77 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.23 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |