C22H20BrCl2F4N3O2 — CID 123409888
2-bromo-4-[3-(3,5-dichloro-4-fluorophenyl)-4,4,4-trifluorobut-1-enyl]-N-[2-(ethylcarbamoylamino)ethyl]benzamide (PubChem CID 123409888) has the molecular formula C22H20BrCl2F4N3O2 and a molecular weight of 585.22 g/mol. Its IUPAC name is 2-bromo-4-[3-(3,5-dichloro-4-fluorophenyl)-4,4,4-trifluorobut-1-enyl]-N-[2-(ethylcarbamoylamino)ethyl]benzamide.
| Compound Name | 2-bromo-4-[3-(3,5-dichloro-4-fluorophenyl)-4,4,4-trifluorobut-1-enyl]-N-[2-(ethylcarbamoylamino)ethyl]benzamide |
|---|---|
| PubChem CID | 123409888 |
| Molecular Formula | C22H20BrCl2F4N3O2 |
| Molecular Weight | 585.22 g/mol |
| Exact Mass | 583.01 |
| IUPAC Name | 2-bromo-4-[3-(3,5-dichloro-4-fluorophenyl)-4,4,4-trifluorobut-1-enyl]-N-[2-(ethylcarbamoylamino)ethyl]benzamide |
| SMILES | CCNC(=O)NCCNC(=O)c1ccc(C=CC(c2cc(Cl)c(F)c(Cl)c2)C(F)(F)F)cc1Br |
| InChI | InChI=1S/C22H20BrCl2F4N3O2/c1-2-30-21(34)32-8-7-31-20(33)14-5-3-12(9-16(14)23)4-6-15(22(27,28)29)13-10-17(24)19(26)18(25)11-13/h3-6,9-11,15H,2,7-8H2,1H3,(H,31,33)(H2,30,32,34) |
| InChIKey | SMRGYXNZZRLPPJ-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.22 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|