C25H17Cl3F9NO2 — CID 148605198
1-[2-oxo-2-[2-(trifluoromethyl)-4-[(E)-4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]phenyl]ethyl]-N-(2,2,2-trifluoroethyl)cyclopropane-1-carboxamide (PubChem CID 148605198) has the molecular formula C25H17Cl3F9NO2 and a molecular weight of 640.76 g/mol. Its IUPAC name is 1-[2-oxo-2-[2-(trifluoromethyl)-4-[(E)-4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]phenyl]ethyl]-N-(2,2,2-trifluoroethyl)cyclopropane-1-carboxamide.
| Compound Name | 1-[2-oxo-2-[2-(trifluoromethyl)-4-[(E)-4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]phenyl]ethyl]-N-(2,2,2-trifluoroethyl)cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 148605198 |
| Molecular Formula | C25H17Cl3F9NO2 |
| Molecular Weight | 640.76 g/mol |
| Exact Mass | 639.02 |
| IUPAC Name | 1-[2-oxo-2-[2-(trifluoromethyl)-4-[(E)-4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]phenyl]ethyl]-N-(2,2,2-trifluoroethyl)cyclopropane-1-carboxamide |
| SMILES | O=C(CC1(C(=O)NCC(F)(F)F)CC1)c1ccc(/C=C/C(c2cc(Cl)c(Cl)c(Cl)c2)C(F)(F)F)cc1C(F)(F)F |
| InChI | InChI=1S/C25H17Cl3F9NO2/c26-17-8-13(9-18(27)20(17)28)15(24(32,33)34)4-2-12-1-3-14(16(7-12)25(35,36)37)19(39)10-22(5-6-22)21(40)38-11-23(29,30)31/h1-4,7-9,15H,5-6,10-11H2,(H,38,40)/b4-2+ |
| InChIKey | NDGQQHQIOARVTH-DUXPYHPUSA-N |
| XLogP | 9.06 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.76 |
| LogP ≤ 5 | 9.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|