C25H16Cl3F10NO2 — CID 130272385
4-[(Z)-1,4,4,4-tetrafluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]-2-(trifluoromethyl)-N-[(E,2R)-7,7,7-trifluoro-3-oxohept-4-en-2-yl]benzamide (PubChem CID 130272385) has the molecular formula C25H16Cl3F10NO2 and a molecular weight of 658.75 g/mol. Its IUPAC name is 4-[(Z)-1,4,4,4-tetrafluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]-2-(trifluoromethyl)-N-[(E,2R)-7,7,7-trifluoro-3-oxohept-4-en-2-yl]benzamide.
| Compound Name | 4-[(Z)-1,4,4,4-tetrafluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]-2-(trifluoromethyl)-N-[(E,2R)-7,7,7-trifluoro-3-oxohept-4-en-2-yl]benzamide |
|---|---|
| PubChem CID | 130272385 |
| Molecular Formula | C25H16Cl3F10NO2 |
| Molecular Weight | 658.75 g/mol |
| Exact Mass | 657.01 |
| IUPAC Name | 4-[(Z)-1,4,4,4-tetrafluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]-2-(trifluoromethyl)-N-[(E,2R)-7,7,7-trifluoro-3-oxohept-4-en-2-yl]benzamide |
| SMILES | C[C@@H](NC(=O)c1ccc(/C(F)=C/C(c2cc(Cl)c(Cl)c(Cl)c2)C(F)(F)F)cc1C(F)(F)F)C(=O)/C=C/CC(F)(F)F |
| InChI | InChI=1S/C25H16Cl3F10NO2/c1-11(20(40)3-2-6-23(30,31)32)39-22(41)14-5-4-12(7-16(14)25(36,37)38)19(29)10-15(24(33,34)35)13-8-17(26)21(28)18(27)9-13/h2-5,7-11,15H,6H2,1H3,(H,39,41)/b3-2+,19-10-/t11-,15?/m1/s1 |
| InChIKey | ZCGITIWWIWMFKR-HTRHFAEKSA-N |
| XLogP | 9.52 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.75 |
| LogP ≤ 5 | 9.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|