C24H18ClF11N2O2 — CID 130236851
4-[(Z)-3-(3-chloro-4-fluorophenyl)-1,4,4,4-tetrafluorobut-1-enyl]-N-[(2R)-1-[methyl(2,2,2-trifluoroethyl)amino]-1-oxopropan-2-yl]-2-(trifluoromethyl)benzamide (PubChem CID 130236851) has the molecular formula C24H18ClF11N2O2 and a molecular weight of 610.85 g/mol. Its IUPAC name is 4-[(Z)-3-(3-chloro-4-fluorophenyl)-1,4,4,4-tetrafluorobut-1-enyl]-N-[(2R)-1-[methyl(2,2,2-trifluoroethyl)amino]-1-oxopropan-2-yl]-2-(trifluoromethyl)benzamide.
| Compound Name | 4-[(Z)-3-(3-chloro-4-fluorophenyl)-1,4,4,4-tetrafluorobut-1-enyl]-N-[(2R)-1-[methyl(2,2,2-trifluoroethyl)amino]-1-oxopropan-2-yl]-2-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 130236851 |
| Molecular Formula | C24H18ClF11N2O2 |
| Molecular Weight | 610.85 g/mol |
| Exact Mass | 610.09 |
| IUPAC Name | 4-[(Z)-3-(3-chloro-4-fluorophenyl)-1,4,4,4-tetrafluorobut-1-enyl]-N-[(2R)-1-[methyl(2,2,2-trifluoroethyl)amino]-1-oxopropan-2-yl]-2-(trifluoromethyl)benzamide |
| SMILES | C[C@@H](NC(=O)c1ccc(/C(F)=C/C(c2ccc(F)c(Cl)c2)C(F)(F)F)cc1C(F)(F)F)C(=O)N(C)CC(F)(F)F |
| InChI | InChI=1S/C24H18ClF11N2O2/c1-11(21(40)38(2)10-22(28,29)30)37-20(39)14-5-3-13(7-16(14)24(34,35)36)19(27)9-15(23(31,32)33)12-4-6-18(26)17(25)8-12/h3-9,11,15H,10H2,1-2H3,(H,37,39)/b19-9-/t11-,15?/m1/s1 |
| InChIKey | TVAYWPXZKNOLCF-ZVHPCQIWSA-N |
| XLogP | 7.29 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.85 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |