C23H16BrClF10N2O2 — CID 130237206
4-[(Z)-3-(3-bromo-4-chlorophenyl)-1,4,4,4-tetrafluorobut-1-enyl]-N-[2-[methyl(2,2,2-trifluoroethyl)amino]-2-oxoethyl]-2-(trifluoromethyl)benzamide (PubChem CID 130237206) has the molecular formula C23H16BrClF10N2O2 and a molecular weight of 657.73 g/mol. Its IUPAC name is 4-[(Z)-3-(3-bromo-4-chlorophenyl)-1,4,4,4-tetrafluorobut-1-enyl]-N-[2-[methyl(2,2,2-trifluoroethyl)amino]-2-oxoethyl]-2-(trifluoromethyl)benzamide.
| Compound Name | 4-[(Z)-3-(3-bromo-4-chlorophenyl)-1,4,4,4-tetrafluorobut-1-enyl]-N-[2-[methyl(2,2,2-trifluoroethyl)amino]-2-oxoethyl]-2-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 130237206 |
| Molecular Formula | C23H16BrClF10N2O2 |
| Molecular Weight | 657.73 g/mol |
| Exact Mass | 655.99 |
| IUPAC Name | 4-[(Z)-3-(3-bromo-4-chlorophenyl)-1,4,4,4-tetrafluorobut-1-enyl]-N-[2-[methyl(2,2,2-trifluoroethyl)amino]-2-oxoethyl]-2-(trifluoromethyl)benzamide |
| SMILES | CN(CC(F)(F)F)C(=O)CNC(=O)c1ccc(/C(F)=C/C(c2ccc(Cl)c(Br)c2)C(F)(F)F)cc1C(F)(F)F |
| InChI | InChI=1S/C23H16BrClF10N2O2/c1-37(10-21(27,28)29)19(38)9-36-20(39)13-4-2-12(6-15(13)23(33,34)35)18(26)8-14(22(30,31)32)11-3-5-17(25)16(24)7-11/h2-8,14H,9-10H2,1H3,(H,36,39)/b18-8- |
| InChIKey | DLKNKNBLXURZLF-LSCVHKIXSA-N |
| XLogP | 7.53 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.73 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |