C22H13Cl2F11N2O2 — CID 130237062
4-[(Z)-3-(3,5-dichloro-4-fluorophenyl)-1,4,4,4-tetrafluorobut-1-enyl]-N-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]-2-(trifluoromethyl)benzamide (PubChem CID 130237062) has the molecular formula C22H13Cl2F11N2O2 and a molecular weight of 617.24 g/mol. Its IUPAC name is 4-[(Z)-3-(3,5-dichloro-4-fluorophenyl)-1,4,4,4-tetrafluorobut-1-enyl]-N-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]-2-(trifluoromethyl)benzamide.
| Compound Name | 4-[(Z)-3-(3,5-dichloro-4-fluorophenyl)-1,4,4,4-tetrafluorobut-1-enyl]-N-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]-2-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 130237062 |
| Molecular Formula | C22H13Cl2F11N2O2 |
| Molecular Weight | 617.24 g/mol |
| Exact Mass | 616.02 |
| IUPAC Name | 4-[(Z)-3-(3,5-dichloro-4-fluorophenyl)-1,4,4,4-tetrafluorobut-1-enyl]-N-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]-2-(trifluoromethyl)benzamide |
| SMILES | O=C(CNC(=O)c1ccc(/C(F)=C/C(c2cc(Cl)c(F)c(Cl)c2)C(F)(F)F)cc1C(F)(F)F)NCC(F)(F)F |
| InChI | InChI=1S/C22H13Cl2F11N2O2/c23-14-4-10(5-15(24)18(14)26)12(21(30,31)32)6-16(25)9-1-2-11(13(3-9)22(33,34)35)19(39)36-7-17(38)37-8-20(27,28)29/h1-6,12H,7-8H2,(H,36,39)(H,37,38)/b16-6- |
| InChIKey | WWJQJQMBRKKKJN-SOFYXZRVSA-N |
| XLogP | 7.22 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.24 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|