C25H20ClF10NO2 — CID 159170237
4-[4-[(Z)-3-(3-chloro-4-ethylphenyl)-1,4,4,4-tetrafluorobut-1-enyl]-2-(trifluoromethyl)phenyl]-4-oxo-N-(2,2,2-trifluoroethyl)butanamide (PubChem CID 159170237) has the molecular formula C25H20ClF10NO2 and a molecular weight of 591.87 g/mol. Its IUPAC name is 4-[4-[(Z)-3-(3-chloro-4-ethylphenyl)-1,4,4,4-tetrafluorobut-1-enyl]-2-(trifluoromethyl)phenyl]-4-oxo-N-(2,2,2-trifluoroethyl)butanamide.
| Compound Name | 4-[4-[(Z)-3-(3-chloro-4-ethylphenyl)-1,4,4,4-tetrafluorobut-1-enyl]-2-(trifluoromethyl)phenyl]-4-oxo-N-(2,2,2-trifluoroethyl)butanamide |
|---|---|
| PubChem CID | 159170237 |
| Molecular Formula | C25H20ClF10NO2 |
| Molecular Weight | 591.87 g/mol |
| Exact Mass | 591.10 |
| IUPAC Name | 4-[4-[(Z)-3-(3-chloro-4-ethylphenyl)-1,4,4,4-tetrafluorobut-1-enyl]-2-(trifluoromethyl)phenyl]-4-oxo-N-(2,2,2-trifluoroethyl)butanamide |
| SMILES | CCc1ccc(C(/C=C(\F)c2ccc(C(=O)CCC(=O)NCC(F)(F)F)c(C(F)(F)F)c2)C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C25H20ClF10NO2/c1-2-13-3-4-14(10-19(13)26)17(24(31,32)33)11-20(27)15-5-6-16(18(9-15)25(34,35)36)21(38)7-8-22(39)37-12-23(28,29)30/h3-6,9-11,17H,2,7-8,12H2,1H3,(H,37,39)/b20-11- |
| InChIKey | KLPCRBLLBXHOMK-JAIQZWGSSA-N |
| XLogP | 8.22 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.87 |
| LogP ≤ 5 | 8.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |